C14H3N2O8-3 — CID 23615439
4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate (PubChem CID 23615439) has the molecular formula C14H3N2O8-3 and a molecular weight of 327.18 g/mol. Its IUPAC name is 4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate.
| Compound Name | 4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate |
|---|---|
| PubChem CID | 23615439 |
| Molecular Formula | C14H3N2O8-3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate |
| SMILES | O=C([O-])c1cc(C(=O)[O-])c2c(n1)C(=O)C(=O)c1cc(C(=O)[O-])[nH]c1-2 |
| InChI | InChI=1S/C14H6N2O8/c17-10-4-2-6(14(23)24)15-8(4)7-3(12(19)20)1-5(13(21)22)16-9(7)11(10)18/h1-2,15H,(H,19,20)(H,21,22)(H,23,24)/p-3 |
| InChIKey | MMXZSJMASHPLLR-UHFFFAOYSA-K |
| XLogP | -3.45 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|