C14H19NO — CID 146163611
(1E)-N-methoxy-5-methyl-1-phenylhexa-1,5-dien-3-amine (PubChem CID 146163611) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (1E)-N-methoxy-5-methyl-1-phenylhexa-1,5-dien-3-amine.
| Compound Name | (1E)-N-methoxy-5-methyl-1-phenylhexa-1,5-dien-3-amine |
|---|---|
| PubChem CID | 146163611 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (1E)-N-methoxy-5-methyl-1-phenylhexa-1,5-dien-3-amine |
| SMILES | C=C(C)CC(/C=C/c1ccccc1)NOC |
| InChI | InChI=1S/C14H19NO/c1-12(2)11-14(15-16-3)10-9-13-7-5-4-6-8-13/h4-10,14-15H,1,11H2,2-3H3/b10-9+ |
| InChIKey | WHEKDIKDWXWXOX-MDZDMXLPSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|