C25H33NO4Zn — CID 146163780
zinc;ethane;[(1S,2S)-5-methoxy-2-methoxycarbonyl-5-oxo-1-phenyl-2-propylpentyl]-phenylazanide (PubChem CID 146163780) has the molecular formula C25H33NO4Zn and a molecular weight of 476.93 g/mol. Its IUPAC name is zinc;ethane;[(1S,2S)-5-methoxy-2-methoxycarbonyl-5-oxo-1-phenyl-2-propylpentyl]-phenylazanide.
| Compound Name | zinc;ethane;[(1S,2S)-5-methoxy-2-methoxycarbonyl-5-oxo-1-phenyl-2-propylpentyl]-phenylazanide |
|---|---|
| PubChem CID | 146163780 |
| Molecular Formula | C25H33NO4Zn |
| Molecular Weight | 476.93 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | zinc;ethane;[(1S,2S)-5-methoxy-2-methoxycarbonyl-5-oxo-1-phenyl-2-propylpentyl]-phenylazanide |
| SMILES | CCC[C@@](CCC(=O)OC)(C(=O)OC)[C@@H]([N-]c1ccccc1)c1ccccc1.[CH2-]C.[Zn+2] |
| InChI | InChI=1S/C23H28NO4.C2H5.Zn/c1-4-16-23(22(26)28-3,17-15-20(25)27-2)21(18-11-7-5-8-12-18)24-19-13-9-6-10-14-19;1-2;/h5-14,21H,4,15-17H2,1-3H3;1H2,2H3;/q2*-1;+2/t21-,23-;;/m0../s1 |
| InChIKey | DQVZTJUCWVFTTH-CPTHQKRGSA-N |
| XLogP | 6.18 |
| TPSA | 66.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.93 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|