C16H16BrIO6 — CID 146164672
[3-acetyloxy-6-(4-bromophenoxy)-5-iodo-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 146164672) has the molecular formula C16H16BrIO6 and a molecular weight of 511.11 g/mol. Its IUPAC name is [3-acetyloxy-6-(4-bromophenoxy)-5-iodo-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-6-(4-bromophenoxy)-5-iodo-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 146164672 |
| Molecular Formula | C16H16BrIO6 |
| Molecular Weight | 511.11 g/mol |
| Exact Mass | 509.92 |
| IUPAC Name | [3-acetyloxy-6-(4-bromophenoxy)-5-iodo-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc(Br)cc2)C(I)=CC1OC(C)=O |
| InChI | InChI=1S/C16H16BrIO6/c1-9(19)21-8-15-14(22-10(2)20)7-13(18)16(24-15)23-12-5-3-11(17)4-6-12/h3-7,14-16H,8H2,1-2H3 |
| InChIKey | KSRUMZAFGZDULK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.11 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|