C46H48N4O6S — CID 146164736
bis[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] thiophene-2,5-dicarboxylate (PubChem CID 146164736) has the molecular formula C46H48N4O6S and a molecular weight of 784.98 g/mol. Its IUPAC name is bis[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] thiophene-2,5-dicarboxylate.
| Compound Name | bis[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] thiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 146164736 |
| Molecular Formula | C46H48N4O6S |
| Molecular Weight | 784.98 g/mol |
| Exact Mass | 784.33 |
| IUPAC Name | bis[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] thiophene-2,5-dicarboxylate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](OC(=O)c1ccc(C(=O)O[C@@H](c2ccnc3ccc(OC)cc23)[C@@H]2C[C@@H]3CCN2C[C@@H]3C=C)s1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C46H48N4O6S/c1-5-27-25-49-19-15-29(27)21-39(49)43(33-13-17-47-37-9-7-31(53-3)23-35(33)37)55-45(51)41-11-12-42(57-41)46(52)56-44(40-22-30-16-20-50(40)26-28(30)6-2)34-14-18-48-38-10-8-32(54-4)24-36(34)38/h5-14,17-18,23-24,27-30,39-40,43-44H,1-2,15-16,19-22,25-26H2,3-4H3/t27-,28-,29-,30-,39-,40-,43-,44-/m0/s1 |
| InChIKey | DLXNVMZGJPHREQ-VWZFBPNJSA-N |
| XLogP | 8.45 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.98 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|