C17H15N — CID 146165743
(2S,3R,4S)-4-phenyl-7-azatetracyclo[6.4.0.02,4.03,7]dodeca-1(12),8,10-triene (PubChem CID 146165743) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is (2S,3R,4S)-4-phenyl-7-azatetracyclo[6.4.0.02,4.03,7]dodeca-1(12),8,10-triene.
| Compound Name | (2S,3R,4S)-4-phenyl-7-azatetracyclo[6.4.0.02,4.03,7]dodeca-1(12),8,10-triene |
|---|---|
| PubChem CID | 146165743 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (2S,3R,4S)-4-phenyl-7-azatetracyclo[6.4.0.02,4.03,7]dodeca-1(12),8,10-triene |
| SMILES | c1ccc([C@]23CCN4c5ccccc5[C@H]2[C@@H]43)cc1 |
| InChI | InChI=1S/C17H15N/c1-2-6-12(7-3-1)17-10-11-18-14-9-5-4-8-13(14)15(17)16(17)18/h1-9,15-16H,10-11H2/t15-,16+,17+/m0/s1 |
| InChIKey | JKRZKVYSFSZCTJ-GVDBMIGSSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |