C25H25N — CID 164666151
(4aS,6R)-4a,6-diphenyl-1,2,3,4,5,6-hexahydrobenzo[c]quinolizine (PubChem CID 164666151) has the molecular formula C25H25N and a molecular weight of 339.48 g/mol. Its IUPAC name is (4aS,6R)-4a,6-diphenyl-1,2,3,4,5,6-hexahydrobenzo[c]quinolizine.
| Compound Name | (4aS,6R)-4a,6-diphenyl-1,2,3,4,5,6-hexahydrobenzo[c]quinolizine |
|---|---|
| PubChem CID | 164666151 |
| Molecular Formula | C25H25N |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (4aS,6R)-4a,6-diphenyl-1,2,3,4,5,6-hexahydrobenzo[c]quinolizine |
| SMILES | c1ccc([C@H]2C[C@]3(c4ccccc4)CCCCN3c3ccccc32)cc1 |
| InChI | InChI=1S/C25H25N/c1-3-11-20(12-4-1)23-19-25(21-13-5-2-6-14-21)17-9-10-18-26(25)24-16-8-7-15-22(23)24/h1-8,11-16,23H,9-10,17-19H2/t23-,25+/m1/s1 |
| InChIKey | XDNZDMILZPGOPO-NOZRDPDXSA-N |
| XLogP | 6.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |