C34H51NO3Si — CID 146167061
tert-butyl (2R,4S,6R)-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-methyl-6-prop-2-enylpiperidine-1-carboxylate (PubChem CID 146167061) has the molecular formula C34H51NO3Si and a molecular weight of 549.87 g/mol. Its IUPAC name is tert-butyl (2R,4S,6R)-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-methyl-6-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S,6R)-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-methyl-6-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 146167061 |
| Molecular Formula | C34H51NO3Si |
| Molecular Weight | 549.87 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | tert-butyl (2R,4S,6R)-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-methyl-6-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CC[C@@H]1C[C@@H](C)C[C@@H](CCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H51NO3Si/c1-9-18-28-25-27(2)26-29(35(28)32(36)38-33(3,4)5)19-16-17-24-37-39(34(6,7)8,30-20-12-10-13-21-30)31-22-14-11-15-23-31/h9-15,20-23,27-29H,1,16-19,24-26H2,2-8H3/t27-,28-,29-/m1/s1 |
| InChIKey | LXRHHQMDTRXNKY-MPFGFTFXSA-N |
| XLogP | 7.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.87 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|