C43H61NO3Si — CID 134853167
tert-butyl (2S,3R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-octylphenyl)-5-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 134853167) has the molecular formula C43H61NO3Si and a molecular weight of 668.05 g/mol. Its IUPAC name is tert-butyl (2S,3R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-octylphenyl)-5-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-octylphenyl)-5-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134853167 |
| Molecular Formula | C43H61NO3Si |
| Molecular Weight | 668.05 g/mol |
| Exact Mass | 667.44 |
| IUPAC Name | tert-butyl (2S,3R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-octylphenyl)-5-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@H]1C[C@H](c2ccc(CCCCCCCC)cc2)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C43H61NO3Si/c1-9-11-12-13-14-17-23-34-28-30-35(31-29-34)39-32-36(22-10-2)44(41(45)47-42(3,4)5)40(39)33-46-48(43(6,7)8,37-24-18-15-19-25-37)38-26-20-16-21-27-38/h10,15-16,18-21,24-31,36,39-40H,2,9,11-14,17,22-23,32-33H2,1,3-8H3/t36-,39+,40+/m0/s1 |
| InChIKey | QGTNYLIGAPXNDP-HOAOOSOUSA-N |
| XLogP | 10.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.05 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|