C36H48F2N2O3Si — CID 59167909
tert-butyl (2R)-2-[(1S,2S)-2-(dibenzylamino)-3-(3,5-difluorophenyl)-1-trimethylsilyloxypropyl]-5-methylpyrrolidine-1-carboxylate (PubChem CID 59167909) has the molecular formula C36H48F2N2O3Si and a molecular weight of 622.87 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1S,2S)-2-(dibenzylamino)-3-(3,5-difluorophenyl)-1-trimethylsilyloxypropyl]-5-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(1S,2S)-2-(dibenzylamino)-3-(3,5-difluorophenyl)-1-trimethylsilyloxypropyl]-5-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59167909 |
| Molecular Formula | C36H48F2N2O3Si |
| Molecular Weight | 622.87 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | tert-butyl (2R)-2-[(1S,2S)-2-(dibenzylamino)-3-(3,5-difluorophenyl)-1-trimethylsilyloxypropyl]-5-methylpyrrolidine-1-carboxylate |
| SMILES | CC1CC[C@H]([C@@H](O[Si](C)(C)C)[C@H](Cc2cc(F)cc(F)c2)N(Cc2ccccc2)Cc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H48F2N2O3Si/c1-26-18-19-32(40(26)35(41)42-36(2,3)4)34(43-44(5,6)7)33(22-29-20-30(37)23-31(38)21-29)39(24-27-14-10-8-11-15-27)25-28-16-12-9-13-17-28/h8-17,20-21,23,26,32-34H,18-19,22,24-25H2,1-7H3/t26?,32-,33+,34-/m1/s1 |
| InChIKey | LLPQAZQUBOYQSB-JJIJDBLKSA-N |
| XLogP | 8.59 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.87 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|