C34H45NO3Si — CID 134866597
tert-butyl (2R)-2-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]piperidine-1-carboxylate (PubChem CID 134866597) has the molecular formula C34H45NO3Si and a molecular weight of 543.82 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134866597 |
| Molecular Formula | C34H45NO3Si |
| Molecular Weight | 543.82 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | tert-butyl (2R)-2-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@@H]1[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C34H45NO3Si/c1-33(2,3)38-32(36)35-25-17-16-24-31(35)30(27-18-10-7-11-19-27)26-37-39(34(4,5)6,28-20-12-8-13-21-28)29-22-14-9-15-23-29/h7-15,18-23,30-31H,16-17,24-26H2,1-6H3/t30-,31-/m1/s1 |
| InChIKey | XUWZYQBECSQHHG-FIRIVFDPSA-N |
| XLogP | 7.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.82 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|