C27H47NO3Si — CID 164674119
tert-butyl 4-(5-phenyl-1-triethylsilyloxypentyl)piperidine-1-carboxylate (PubChem CID 164674119) has the molecular formula C27H47NO3Si and a molecular weight of 461.76 g/mol. Its IUPAC name is tert-butyl 4-(5-phenyl-1-triethylsilyloxypentyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-phenyl-1-triethylsilyloxypentyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164674119 |
| Molecular Formula | C27H47NO3Si |
| Molecular Weight | 461.76 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | tert-butyl 4-(5-phenyl-1-triethylsilyloxypentyl)piperidine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)OC(CCCCc1ccccc1)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C27H47NO3Si/c1-7-32(8-2,9-3)31-25(18-14-13-17-23-15-11-10-12-16-23)24-19-21-28(22-20-24)26(29)30-27(4,5)6/h10-12,15-16,24-25H,7-9,13-14,17-22H2,1-6H3 |
| InChIKey | OVMMMUVVUMUECH-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.76 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|