C34H39NO3Si — CID 135066368
(4R)-4-benzyl-3-[(5E)-8-[tert-butyl(diphenyl)silyl]oxyocta-1,2,5-trien-3-yl]-1,3-oxazolidin-2-one (PubChem CID 135066368) has the molecular formula C34H39NO3Si and a molecular weight of 537.78 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(5E)-8-[tert-butyl(diphenyl)silyl]oxyocta-1,2,5-trien-3-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(5E)-8-[tert-butyl(diphenyl)silyl]oxyocta-1,2,5-trien-3-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135066368 |
| Molecular Formula | C34H39NO3Si |
| Molecular Weight | 537.78 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | (4R)-4-benzyl-3-[(5E)-8-[tert-butyl(diphenyl)silyl]oxyocta-1,2,5-trien-3-yl]-1,3-oxazolidin-2-one |
| SMILES | C=C=C(C/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C34H39NO3Si/c1-5-29(35-30(27-37-33(35)36)26-28-18-10-6-11-19-28)20-12-9-17-25-38-39(34(2,3)4,31-21-13-7-14-22-31)32-23-15-8-16-24-32/h6-16,18-19,21-24,30H,1,17,20,25-27H2,2-4H3/b12-9+/t30-/m1/s1 |
| InChIKey | IMDNTEFNTSWGCO-LFNCSFBISA-N |
| XLogP | 6.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.78 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|