C31H47NO3Si — CID 146167060
tert-butyl (2R,4R)-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-methylpiperidine-1-carboxylate (PubChem CID 146167060) has the molecular formula C31H47NO3Si and a molecular weight of 509.81 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 146167060 |
| Molecular Formula | C31H47NO3Si |
| Molecular Weight | 509.81 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | tert-butyl (2R,4R)-2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1CCN(C(=O)OC(C)(C)C)[C@H](CCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C31H47NO3Si/c1-25-21-22-32(29(33)35-30(2,3)4)26(24-25)16-14-15-23-34-36(31(5,6)7,27-17-10-8-11-18-27)28-19-12-9-13-20-28/h8-13,17-20,25-26H,14-16,21-24H2,1-7H3/t25-,26-/m1/s1 |
| InChIKey | PADXDPQXHNSCMT-CLJLJLNGSA-N |
| XLogP | 6.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.81 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|