C18H19N5 — CID 14616725
N-[(E)-[(4,5-dimethyltriazol-2-yl)-(4-methylphenyl)methylidene]amino]aniline (PubChem CID 14616725) has the molecular formula C18H19N5 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[(E)-[(4,5-dimethyltriazol-2-yl)-(4-methylphenyl)methylidene]amino]aniline.
| Compound Name | N-[(E)-[(4,5-dimethyltriazol-2-yl)-(4-methylphenyl)methylidene]amino]aniline |
|---|---|
| PubChem CID | 14616725 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-[(E)-[(4,5-dimethyltriazol-2-yl)-(4-methylphenyl)methylidene]amino]aniline |
| SMILES | Cc1ccc(/C(=N\Nc2ccccc2)n2nc(C)c(C)n2)cc1 |
| InChI | InChI=1S/C18H19N5/c1-13-9-11-16(12-10-13)18(23-21-14(2)15(3)22-23)20-19-17-7-5-4-6-8-17/h4-12,19H,1-3H3/b20-18+ |
| InChIKey | JUEGCFRWSPAALL-CZIZESTLSA-N |
| XLogP | 3.53 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|