C17H18BrN7 — CID 22403012
3-(4,5-dimethyltriazol-2-yl)-2,5-diphenyl-1H-tetrazol-1-ium bromide (PubChem CID 22403012) has the molecular formula C17H18BrN7 and a molecular weight of 400.28 g/mol. Its IUPAC name is 3-(4,5-dimethyltriazol-2-yl)-2,5-diphenyl-1H-tetrazol-1-ium bromide.
| Compound Name | 3-(4,5-dimethyltriazol-2-yl)-2,5-diphenyl-1H-tetrazol-1-ium bromide |
|---|---|
| PubChem CID | 22403012 |
| Molecular Formula | C17H18BrN7 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 3-(4,5-dimethyltriazol-2-yl)-2,5-diphenyl-1H-tetrazol-1-ium bromide |
| SMILES | Cc1nn(N2N=C(c3ccccc3)[NH2+]N2c2ccccc2)nc1C.[Br-] |
| InChI | InChI=1S/C17H17N7.BrH/c1-13-14(2)19-23(18-13)24-21-17(15-9-5-3-6-10-15)20-22(24)16-11-7-4-8-12-16;/h3-12H,1-2H3,(H,20,21);1H |
| InChIKey | RJMKBHYBUZFPSL-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|