C17H17N7 — CID 22403013
3-(4,5-dimethyltriazol-2-yl)-2,5-diphenyl-1H-tetrazole (PubChem CID 22403013) has the molecular formula C17H17N7 and a molecular weight of 319.37 g/mol. Its IUPAC name is 3-(4,5-dimethyltriazol-2-yl)-2,5-diphenyl-1H-tetrazole.
| Compound Name | 3-(4,5-dimethyltriazol-2-yl)-2,5-diphenyl-1H-tetrazole |
|---|---|
| PubChem CID | 22403013 |
| Molecular Formula | C17H17N7 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 3-(4,5-dimethyltriazol-2-yl)-2,5-diphenyl-1H-tetrazole |
| SMILES | Cc1nn(N2N=C(c3ccccc3)NN2c2ccccc2)nc1C |
| InChI | InChI=1S/C17H17N7/c1-13-14(2)19-23(18-13)24-21-17(15-9-5-3-6-10-15)20-22(24)16-11-7-4-8-12-16/h3-12H,1-2H3,(H,20,21) |
| InChIKey | YEWWODGWOZFCSR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |