C17H16N7+ — CID 67359495
2-(4,5-dimethyltriazol-2-yl)-2,5-diphenyltetrazol-2-ium (PubChem CID 67359495) has the molecular formula C17H16N7+ and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-(4,5-dimethyltriazol-2-yl)-2,5-diphenyltetrazol-2-ium.
| Compound Name | 2-(4,5-dimethyltriazol-2-yl)-2,5-diphenyltetrazol-2-ium |
|---|---|
| PubChem CID | 67359495 |
| Molecular Formula | C17H16N7+ |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-(4,5-dimethyltriazol-2-yl)-2,5-diphenyltetrazol-2-ium |
| SMILES | Cc1nn([N+]2(c3ccccc3)N=NC(c3ccccc3)=N2)nc1C |
| InChI | InChI=1S/C17H16N7/c1-13-14(2)20-23(19-13)24(16-11-7-4-8-12-16)21-17(18-22-24)15-9-5-3-6-10-15/h3-12H,1-2H3/q+1 |
| InChIKey | ZGRWPLCCAPOONR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|