C17H17N5 — CID 14381183
N-[(E)-[(4,5-dimethyltriazol-1-yl)-phenylmethylidene]amino]aniline (PubChem CID 14381183) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is N-[(E)-[(4,5-dimethyltriazol-1-yl)-phenylmethylidene]amino]aniline.
| Compound Name | N-[(E)-[(4,5-dimethyltriazol-1-yl)-phenylmethylidene]amino]aniline |
|---|---|
| PubChem CID | 14381183 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-[(E)-[(4,5-dimethyltriazol-1-yl)-phenylmethylidene]amino]aniline |
| SMILES | Cc1nnn(/C(=N/Nc2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C17H17N5/c1-13-14(2)22(21-18-13)17(15-9-5-3-6-10-15)20-19-16-11-7-4-8-12-16/h3-12,19H,1-2H3/b20-17+ |
| InChIKey | JQSFGBSATQAZBA-LVZFUZTISA-N |
| XLogP | 3.22 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|