C15H16O7 — CID 146167342
(4aR,9R,9aR)-5,6-dihydroxy-1-methoxy-4a,8-dimethyl-3,4-dioxo-9,9a-dihydrobenzo[7]annulene-9-carboxylic acid (PubChem CID 146167342) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is (4aR,9R,9aR)-5,6-dihydroxy-1-methoxy-4a,8-dimethyl-3,4-dioxo-9,9a-dihydrobenzo[7]annulene-9-carboxylic acid.
| Compound Name | (4aR,9R,9aR)-5,6-dihydroxy-1-methoxy-4a,8-dimethyl-3,4-dioxo-9,9a-dihydrobenzo[7]annulene-9-carboxylic acid |
|---|---|
| PubChem CID | 146167342 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (4aR,9R,9aR)-5,6-dihydroxy-1-methoxy-4a,8-dimethyl-3,4-dioxo-9,9a-dihydrobenzo[7]annulene-9-carboxylic acid |
| SMILES | COC1=CC(=O)C(=O)[C@@]2(C)C(O)=C(O)C=C(C)[C@H](C(=O)O)[C@@H]12 |
| InChI | InChI=1S/C15H16O7/c1-6-4-7(16)12(18)15(2)11(10(6)14(20)21)9(22-3)5-8(17)13(15)19/h4-5,10-11,16,18H,1-3H3,(H,20,21)/t10-,11+,15+/m0/s1 |
| InChIKey | CPSLXUQHIHPPJK-FIXISWKDSA-N |
| XLogP | 1.28 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|