C27H34FN5O2Si — CID 146167584
2-[[5-ethyl-2-fluoro-4-[3-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-6-yl]phenoxy]methoxy]ethyl-trimethylsilane (PubChem CID 146167584) has the molecular formula C27H34FN5O2Si and a molecular weight of 507.69 g/mol. Its IUPAC name is 2-[[5-ethyl-2-fluoro-4-[3-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-6-yl]phenoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-ethyl-2-fluoro-4-[3-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-6-yl]phenoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 146167584 |
| Molecular Formula | C27H34FN5O2Si |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 2-[[5-ethyl-2-fluoro-4-[3-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)-1H-indazol-6-yl]phenoxy]methoxy]ethyl-trimethylsilane |
| SMILES | CCc1cc(OCOCC[Si](C)(C)C)c(F)cc1-c1ccc2c(-c3nc4c([nH]3)CNCC4)n[nH]c2c1 |
| InChI | InChI=1S/C27H34FN5O2Si/c1-5-17-13-25(35-16-34-10-11-36(2,3)4)21(28)14-20(17)18-6-7-19-23(12-18)32-33-26(19)27-30-22-8-9-29-15-24(22)31-27/h6-7,12-14,29H,5,8-11,15-16H2,1-4H3,(H,30,31)(H,32,33) |
| InChIKey | FIEFOBCUBWAVMJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|