C29H39FN6O4SSi — CID 146167606
6-[2-ethyl-5-fluoro-4-(2-trimethylsilylethoxymethoxy)phenyl]-N,N-dimethyl-3-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)indazole-1-sulfonamide (PubChem CID 146167606) has the molecular formula C29H39FN6O4SSi and a molecular weight of 614.82 g/mol. Its IUPAC name is 6-[2-ethyl-5-fluoro-4-(2-trimethylsilylethoxymethoxy)phenyl]-N,N-dimethyl-3-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)indazole-1-sulfonamide.
| Compound Name | 6-[2-ethyl-5-fluoro-4-(2-trimethylsilylethoxymethoxy)phenyl]-N,N-dimethyl-3-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)indazole-1-sulfonamide |
|---|---|
| PubChem CID | 146167606 |
| Molecular Formula | C29H39FN6O4SSi |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 6-[2-ethyl-5-fluoro-4-(2-trimethylsilylethoxymethoxy)phenyl]-N,N-dimethyl-3-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)indazole-1-sulfonamide |
| SMILES | CCc1cc(OCOCC[Si](C)(C)C)c(F)cc1-c1ccc2c(-c3nc4c([nH]3)CNCC4)nn(S(=O)(=O)N(C)C)c2c1 |
| InChI | InChI=1S/C29H39FN6O4SSi/c1-7-19-15-27(40-18-39-12-13-42(4,5)6)23(30)16-22(19)20-8-9-21-26(14-20)36(41(37,38)35(2)3)34-28(21)29-32-24-10-11-31-17-25(24)33-29/h8-9,14-16,31H,7,10-13,17-18H2,1-6H3,(H,32,33) |
| InChIKey | AYSJVGGVIUXPFW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|