C22H30N2O6S2 — CID 146167846
4-(dipropylsulfamoyl)-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]benzoic acid (PubChem CID 146167846) has the molecular formula C22H30N2O6S2 and a molecular weight of 482.62 g/mol. Its IUPAC name is 4-(dipropylsulfamoyl)-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]benzoic acid.
| Compound Name | 4-(dipropylsulfamoyl)-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 146167846 |
| Molecular Formula | C22H30N2O6S2 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 4-(dipropylsulfamoyl)-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]benzoic acid |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)O)c(CCNS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H30N2O6S2/c1-4-14-24(15-5-2)32(29,30)20-10-11-21(22(25)26)18(16-20)12-13-23-31(27,28)19-8-6-17(3)7-9-19/h6-11,16,23H,4-5,12-15H2,1-3H3,(H,25,26) |
| InChIKey | NQGZYGIOUJRTNX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |