C10H19NO3 — CID 146168098
(3S)-2,2,5-trimethyl-3-(nitromethyl)hexanal (PubChem CID 146168098) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (3S)-2,2,5-trimethyl-3-(nitromethyl)hexanal.
| Compound Name | (3S)-2,2,5-trimethyl-3-(nitromethyl)hexanal |
|---|---|
| PubChem CID | 146168098 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (3S)-2,2,5-trimethyl-3-(nitromethyl)hexanal |
| SMILES | CC(C)C[C@H](C[N+](=O)[O-])C(C)(C)C=O |
| InChI | InChI=1S/C10H19NO3/c1-8(2)5-9(6-11(13)14)10(3,4)7-12/h7-9H,5-6H2,1-4H3/t9-/m1/s1 |
| InChIKey | JQPAGMKDPCIADD-SECBINFHSA-N |
| XLogP | 2.15 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|