C20H18FNO3 — CID 146168158
methyl 2-acetyl-1-(3-fluorophenyl)-6b-methyl-1aH-cyclopropa[b]indole-1-carboxylate (PubChem CID 146168158) has the molecular formula C20H18FNO3 and a molecular weight of 339.37 g/mol. Its IUPAC name is methyl 2-acetyl-1-(3-fluorophenyl)-6b-methyl-1aH-cyclopropa[b]indole-1-carboxylate.
| Compound Name | methyl 2-acetyl-1-(3-fluorophenyl)-6b-methyl-1aH-cyclopropa[b]indole-1-carboxylate |
|---|---|
| PubChem CID | 146168158 |
| Molecular Formula | C20H18FNO3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl 2-acetyl-1-(3-fluorophenyl)-6b-methyl-1aH-cyclopropa[b]indole-1-carboxylate |
| SMILES | COC(=O)C1(c2cccc(F)c2)C2N(C(C)=O)c3ccccc3C21C |
| InChI | InChI=1S/C20H18FNO3/c1-12(23)22-16-10-5-4-9-15(16)19(2)17(22)20(19,18(24)25-3)13-7-6-8-14(21)11-13/h4-11,17H,1-3H3 |
| InChIKey | LOSWCFAHTZLALP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |