C16H22F3N3O — CID 146168287
(3Z)-3-[4-(1-butylpyrrol-3-yl)-1,4-diazepan-2-ylidene]-1,1,1-trifluoropropan-2-one (PubChem CID 146168287) has the molecular formula C16H22F3N3O and a molecular weight of 329.37 g/mol. Its IUPAC name is (3Z)-3-[4-(1-butylpyrrol-3-yl)-1,4-diazepan-2-ylidene]-1,1,1-trifluoropropan-2-one.
| Compound Name | (3Z)-3-[4-(1-butylpyrrol-3-yl)-1,4-diazepan-2-ylidene]-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 146168287 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (3Z)-3-[4-(1-butylpyrrol-3-yl)-1,4-diazepan-2-ylidene]-1,1,1-trifluoropropan-2-one |
| SMILES | CCCCn1ccc(N2CCCN/C(=C\C(=O)C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C16H22F3N3O/c1-2-3-7-21-9-5-14(12-21)22-8-4-6-20-13(11-22)10-15(23)16(17,18)19/h5,9-10,12,20H,2-4,6-8,11H2,1H3/b13-10- |
| InChIKey | LSPQUVIIJRCUGK-RAXLEYEMSA-N |
| XLogP | 3.10 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|