C15H18FN3O4S2 — CID 146168530
(5R)-5-(2-fluoro-5-nitrophenyl)-5-methyl-9,9-dioxo-2,9λ6-dithia-4-azaspiro[5.5]undec-3-en-3-amine (PubChem CID 146168530) has the molecular formula C15H18FN3O4S2 and a molecular weight of 387.46 g/mol. Its IUPAC name is (5R)-5-(2-fluoro-5-nitrophenyl)-5-methyl-9,9-dioxo-2,9λ6-dithia-4-azaspiro[5.5]undec-3-en-3-amine.
| Compound Name | (5R)-5-(2-fluoro-5-nitrophenyl)-5-methyl-9,9-dioxo-2,9λ6-dithia-4-azaspiro[5.5]undec-3-en-3-amine |
|---|---|
| PubChem CID | 146168530 |
| Molecular Formula | C15H18FN3O4S2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (5R)-5-(2-fluoro-5-nitrophenyl)-5-methyl-9,9-dioxo-2,9λ6-dithia-4-azaspiro[5.5]undec-3-en-3-amine |
| SMILES | C[C@]1(c2cc([N+](=O)[O-])ccc2F)N=C(N)SCC12CCS(=O)(=O)CC2 |
| InChI | InChI=1S/C15H18FN3O4S2/c1-14(11-8-10(19(20)21)2-3-12(11)16)15(9-24-13(17)18-14)4-6-25(22,23)7-5-15/h2-3,8H,4-7,9H2,1H3,(H2,17,18)/t14-/m1/s1 |
| InChIKey | WMGDWPBPYHWJNH-CQSZACIVSA-N |
| XLogP | 2.21 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|