C15H20FN3O2S2 — CID 146168529
(5R)-5-(5-amino-2-fluorophenyl)-5-methyl-9,9-dioxo-2,9λ6-dithia-4-azaspiro[5.5]undec-3-en-3-amine (PubChem CID 146168529) has the molecular formula C15H20FN3O2S2 and a molecular weight of 357.48 g/mol. Its IUPAC name is (5R)-5-(5-amino-2-fluorophenyl)-5-methyl-9,9-dioxo-2,9λ6-dithia-4-azaspiro[5.5]undec-3-en-3-amine.
| Compound Name | (5R)-5-(5-amino-2-fluorophenyl)-5-methyl-9,9-dioxo-2,9λ6-dithia-4-azaspiro[5.5]undec-3-en-3-amine |
|---|---|
| PubChem CID | 146168529 |
| Molecular Formula | C15H20FN3O2S2 |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (5R)-5-(5-amino-2-fluorophenyl)-5-methyl-9,9-dioxo-2,9λ6-dithia-4-azaspiro[5.5]undec-3-en-3-amine |
| SMILES | C[C@]1(c2cc(N)ccc2F)N=C(N)SCC12CCS(=O)(=O)CC2 |
| InChI | InChI=1S/C15H20FN3O2S2/c1-14(11-8-10(17)2-3-12(11)16)15(9-22-13(18)19-14)4-6-23(20,21)7-5-15/h2-3,8H,4-7,9,17H2,1H3,(H2,18,19)/t14-/m1/s1 |
| InChIKey | UOVXGSUKMPTZBK-CQSZACIVSA-N |
| XLogP | 1.88 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|