C12H12FN3O2S — CID 58376887
(4R)-4-(2-fluoro-5-nitrophenyl)-4,5-dimethyl-1,3-thiazin-2-amine (PubChem CID 58376887) has the molecular formula C12H12FN3O2S and a molecular weight of 281.31 g/mol. Its IUPAC name is (4R)-4-(2-fluoro-5-nitrophenyl)-4,5-dimethyl-1,3-thiazin-2-amine.
| Compound Name | (4R)-4-(2-fluoro-5-nitrophenyl)-4,5-dimethyl-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 58376887 |
| Molecular Formula | C12H12FN3O2S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | (4R)-4-(2-fluoro-5-nitrophenyl)-4,5-dimethyl-1,3-thiazin-2-amine |
| SMILES | CC1=CSC(N)=N[C@]1(C)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C12H12FN3O2S/c1-7-6-19-11(14)15-12(7,2)9-5-8(16(17)18)3-4-10(9)13/h3-6H,1-2H3,(H2,14,15)/t12-/m0/s1 |
| InChIKey | YDVFQJPAWFUPSD-LBPRGKRZSA-N |
| XLogP | 2.91 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|