C16H26O6Si — CID 146170197
methyl (1R,2S,3R,6R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]hept-4-ene-2-carboxylate (PubChem CID 146170197) has the molecular formula C16H26O6Si and a molecular weight of 342.46 g/mol. Its IUPAC name is methyl (1R,2S,3R,6R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]hept-4-ene-2-carboxylate.
| Compound Name | methyl (1R,2S,3R,6R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]hept-4-ene-2-carboxylate |
|---|---|
| PubChem CID | 146170197 |
| Molecular Formula | C16H26O6Si |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | methyl (1R,2S,3R,6R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]hept-4-ene-2-carboxylate |
| SMILES | COC(=O)[C@]1(OC(C)=O)[C@@H]2O[C@@H]2C=C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H26O6Si/c1-10(17)21-16(14(18)19-5)12(9-8-11-13(16)20-11)22-23(6,7)15(2,3)4/h8-9,11-13H,1-7H3/t11-,12-,13-,16-/m1/s1 |
| InChIKey | CDKCAYCMRSHWOX-BRXULGCHSA-N |
| XLogP | 2.19 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|