C10H11NOS — CID 14617414
(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanol (PubChem CID 14617414) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is (2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanol.
| Compound Name | (2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanol |
|---|---|
| PubChem CID | 14617414 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | (2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanol |
| SMILES | OCC1CSC(c2ccccc2)=N1 |
| InChI | InChI=1S/C10H11NOS/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-5,9,12H,6-7H2 |
| InChIKey | HYKRINDPYGQNSQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |