C25H44O2 — CID 146174374
(8E,10Z,13Z)-7,16,17-trimethyldocosa-8,10,13-trienoic acid (PubChem CID 146174374) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is (8E,10Z,13Z)-7,16,17-trimethyldocosa-8,10,13-trienoic acid.
| Compound Name | (8E,10Z,13Z)-7,16,17-trimethyldocosa-8,10,13-trienoic acid |
|---|---|
| PubChem CID | 146174374 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | (8E,10Z,13Z)-7,16,17-trimethyldocosa-8,10,13-trienoic acid |
| SMILES | CCCCCC(C)C(C)C/C=C\C/C=C\C=C\C(C)CCCCCC(=O)O |
| InChI | InChI=1S/C25H44O2/c1-5-6-12-19-23(3)24(4)20-15-10-8-7-9-13-17-22(2)18-14-11-16-21-25(26)27/h7,9-10,13,15,17,22-24H,5-6,8,11-12,14,16,18-21H2,1-4H3,(H,26,27)/b9-7-,15-10-,17-13+ |
| InChIKey | PFWNMIJXTWEBBB-OFYWBWMPSA-N |
| XLogP | 7.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|