C25H40O2 — CID 146174364
(6E,8E,10Z,13Z,15E)-4,5,17-trimethyldocosa-6,8,10,13,15-pentaenoic acid (PubChem CID 146174364) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is (6E,8E,10Z,13Z,15E)-4,5,17-trimethyldocosa-6,8,10,13,15-pentaenoic acid.
| Compound Name | (6E,8E,10Z,13Z,15E)-4,5,17-trimethyldocosa-6,8,10,13,15-pentaenoic acid |
|---|---|
| PubChem CID | 146174364 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (6E,8E,10Z,13Z,15E)-4,5,17-trimethyldocosa-6,8,10,13,15-pentaenoic acid |
| SMILES | CCCCCC(C)/C=C/C=C\C/C=C\C=C\C=C\C(C)C(C)CCC(=O)O |
| InChI | InChI=1S/C25H40O2/c1-5-6-14-17-22(2)18-15-12-10-8-7-9-11-13-16-19-23(3)24(4)20-21-25(26)27/h7,9-13,15-16,18-19,22-24H,5-6,8,14,17,20-21H2,1-4H3,(H,26,27)/b9-7-,12-10-,13-11+,18-15+,19-16+ |
| InChIKey | LNNCNUFIHIFXKW-FXSAIYNLSA-N |
| XLogP | 7.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|