C31H31N5O2 — CID 146177293
1-[3-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]but-2-yn-1-one (PubChem CID 146177293) has the molecular formula C31H31N5O2 and a molecular weight of 505.62 g/mol. Its IUPAC name is 1-[3-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]but-2-yn-1-one.
| Compound Name | 1-[3-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 146177293 |
| Molecular Formula | C31H31N5O2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 1-[3-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CC2CCCC2C1c1nc(-c2ccc(C(C)(O)c3ccccc3)cc2)c2c(N)nccn12 |
| InChI | InChI=1S/C31H31N5O2/c1-3-8-25(37)36-19-21-9-7-12-24(21)27(36)30-34-26(28-29(32)33-17-18-35(28)30)20-13-15-23(16-14-20)31(2,38)22-10-5-4-6-11-22/h4-6,10-11,13-18,21,24,27,38H,7,9,12,19H2,1-2H3,(H2,32,33) |
| InChIKey | DAMQETAFZBXZBL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|