C27H24N6O2 — CID 146177230
1-[(2R,5S)-4-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,3-diazatricyclo[3.1.0.02,6]hexan-3-yl]prop-2-en-1-one (PubChem CID 146177230) has the molecular formula C27H24N6O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is 1-[(2R,5S)-4-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,3-diazatricyclo[3.1.0.02,6]hexan-3-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,5S)-4-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,3-diazatricyclo[3.1.0.02,6]hexan-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146177230 |
| Molecular Formula | C27H24N6O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1-[(2R,5S)-4-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,3-diazatricyclo[3.1.0.02,6]hexan-3-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C(c2nc(-c3ccc(C(C)(O)c4ccccc4)cc3)c3c(N)nccn23)[C@@H]2C3[C@@H]1N32 |
| InChI | InChI=1S/C27H24N6O2/c1-3-18(34)32-22(21-23-26(32)33(21)23)25-30-19(20-24(28)29-13-14-31(20)25)15-9-11-17(12-10-15)27(2,35)16-7-5-4-6-8-16/h3-14,21-23,26,35H,1H2,2H3,(H2,28,29)/t21-,22?,23?,26+,27?,33?/m1/s1 |
| InChIKey | BCYVSXIRLIITFE-NWALRWLWSA-N |
| XLogP | 2.70 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|