About 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione
3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione (PubChem CID 146180088) has the molecular formula C15H26N2S2
and a molecular weight of 298.52 g/mol. Its IUPAC name is 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione.
Molecular Properties
| Compound Name | 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione |
| PubChem CID | 146180088 |
| Molecular Formula | C15H26N2S2 |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione |
| SMILES | CN(C)c1c(N(C)CCCCC(C)(C)C)c(=S)c1=S |
| InChI | InChI=1S/C15H26N2S2/c1-15(2,3)9-7-8-10-17(6)12-11(16(4)5)13(18)14(12)19/h7-10H2,1-6H3 |
| InChIKey | RLGFFIWGVHDGDC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione?
The IUPAC name of 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione (CID 146180088) is 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione.
What is the SMILES notation for 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione?
The canonical SMILES for 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione is CN(C)c1c(N(C)CCCCC(C)(C)C)c(=S)c1=S.
What is the InChIKey of 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione?
The InChIKey is RLGFFIWGVHDGDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2S2/c1-15(2,3)9-7-8-10-17(6)12-11(16(4)5)13(18)14(12)19/h7-10H2,1-6H3.
What are the key properties of 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione?
3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione has a molecular weight of 298.52 g/mol, XLogP of 4.74, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-4-[5,5-dimethylhexyl(methyl)amino]cyclobut-3-ene-1,2-dithione is sourced from PubChem (CID 146180088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).