C14H24N2OS — CID 146180675
2-[4,4-dimethylpentyl(methyl)amino]-3-(ethylamino)-4-sulfanylidenecyclobut-2-en-1-one (PubChem CID 146180675) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-[4,4-dimethylpentyl(methyl)amino]-3-(ethylamino)-4-sulfanylidenecyclobut-2-en-1-one.
| Compound Name | 2-[4,4-dimethylpentyl(methyl)amino]-3-(ethylamino)-4-sulfanylidenecyclobut-2-en-1-one |
|---|---|
| PubChem CID | 146180675 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-[4,4-dimethylpentyl(methyl)amino]-3-(ethylamino)-4-sulfanylidenecyclobut-2-en-1-one |
| SMILES | CCNc1c(N(C)CCCC(C)(C)C)c(=O)c1=S |
| InChI | InChI=1S/C14H24N2OS/c1-6-15-10-11(12(17)13(10)18)16(5)9-7-8-14(2,3)4/h15H,6-9H2,1-5H3 |
| InChIKey | SMBRKDHCUGVTSH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|