C13H21NOS — CID 157464516
3-(4,4-dimethylpentyl)-2-(ethylamino)-4-sulfanylidenecyclobut-2-en-1-one (PubChem CID 157464516) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is 3-(4,4-dimethylpentyl)-2-(ethylamino)-4-sulfanylidenecyclobut-2-en-1-one.
| Compound Name | 3-(4,4-dimethylpentyl)-2-(ethylamino)-4-sulfanylidenecyclobut-2-en-1-one |
|---|---|
| PubChem CID | 157464516 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-(4,4-dimethylpentyl)-2-(ethylamino)-4-sulfanylidenecyclobut-2-en-1-one |
| SMILES | CCNc1c(CCCC(C)(C)C)c(=S)c1=O |
| InChI | InChI=1S/C13H21NOS/c1-5-14-10-9(12(16)11(10)15)7-6-8-13(2,3)4/h14H,5-8H2,1-4H3 |
| InChIKey | RBYSRYXDJHDMJU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|