C12H19NO2S — CID 166507064
3-(4,4-dimethylpentylamino)-4-methylsulfanylcyclobut-3-ene-1,2-dione (PubChem CID 166507064) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 3-(4,4-dimethylpentylamino)-4-methylsulfanylcyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4,4-dimethylpentylamino)-4-methylsulfanylcyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 166507064 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3-(4,4-dimethylpentylamino)-4-methylsulfanylcyclobut-3-ene-1,2-dione |
| SMILES | CSc1c(NCCCC(C)(C)C)c(=O)c1=O |
| InChI | InChI=1S/C12H19NO2S/c1-12(2,3)6-5-7-13-8-9(14)10(15)11(8)16-4/h13H,5-7H2,1-4H3 |
| InChIKey | ZQHUSZCCCKKXRW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|