C12H22N2O2 — CID 167418954
3-(4,4-dimethylpentylamino)-4-(methylamino)cyclobutane-1,2-dione (PubChem CID 167418954) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-(4,4-dimethylpentylamino)-4-(methylamino)cyclobutane-1,2-dione.
| Compound Name | 3-(4,4-dimethylpentylamino)-4-(methylamino)cyclobutane-1,2-dione |
|---|---|
| PubChem CID | 167418954 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 3-(4,4-dimethylpentylamino)-4-(methylamino)cyclobutane-1,2-dione |
| SMILES | CNC1C(=O)C(=O)C1NCCCC(C)(C)C |
| InChI | InChI=1S/C12H22N2O2/c1-12(2,3)6-5-7-14-9-8(13-4)10(15)11(9)16/h8-9,13-14H,5-7H2,1-4H3 |
| InChIKey | CUKVUHQYHCCISC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|