C32H61N3OS — CID 166507084
2-[4,4-dimethylpentyl(methyl)amino]-3-[3-(dioctylamino)propyl-methylamino]-4-sulfanylidenecyclobut-2-en-1-one (PubChem CID 166507084) has the molecular formula C32H61N3OS and a molecular weight of 535.93 g/mol. Its IUPAC name is 2-[4,4-dimethylpentyl(methyl)amino]-3-[3-(dioctylamino)propyl-methylamino]-4-sulfanylidenecyclobut-2-en-1-one.
| Compound Name | 2-[4,4-dimethylpentyl(methyl)amino]-3-[3-(dioctylamino)propyl-methylamino]-4-sulfanylidenecyclobut-2-en-1-one |
|---|---|
| PubChem CID | 166507084 |
| Molecular Formula | C32H61N3OS |
| Molecular Weight | 535.93 g/mol |
| Exact Mass | 535.45 |
| IUPAC Name | 2-[4,4-dimethylpentyl(methyl)amino]-3-[3-(dioctylamino)propyl-methylamino]-4-sulfanylidenecyclobut-2-en-1-one |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCN(C)c1c(N(C)CCCC(C)(C)C)c(=O)c1=S |
| InChI | InChI=1S/C32H61N3OS/c1-8-10-12-14-16-18-25-35(26-19-17-15-13-11-9-2)27-21-24-34(7)29-28(30(36)31(29)37)33(6)23-20-22-32(3,4)5/h8-27H2,1-7H3 |
| InChIKey | JMNPGGSJGFVJEY-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.93 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|