C15H26O4 — CID 146182232
3-O-tert-butyl 1-O-[(Z)-5,5-dimethylhex-2-enyl] propanedioate (PubChem CID 146182232) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-[(Z)-5,5-dimethylhex-2-enyl] propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-[(Z)-5,5-dimethylhex-2-enyl] propanedioate |
|---|---|
| PubChem CID | 146182232 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 3-O-tert-butyl 1-O-[(Z)-5,5-dimethylhex-2-enyl] propanedioate |
| SMILES | CC(C)(C)C/C=C\COC(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26O4/c1-14(2,3)9-7-8-10-18-12(16)11-13(17)19-15(4,5)6/h7-8H,9-11H2,1-6H3/b8-7- |
| InChIKey | UWYJQXCEWYLLTN-FPLPWBNLSA-N |
| XLogP | 3.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|