C14H24O4S2 — CID 11681305
3-O-tert-butyl 1-O-[(E)-3-(1-methylsulfanylpropylsulfanyl)prop-2-enyl] propanedioate (PubChem CID 11681305) has the molecular formula C14H24O4S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-[(E)-3-(1-methylsulfanylpropylsulfanyl)prop-2-enyl] propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-[(E)-3-(1-methylsulfanylpropylsulfanyl)prop-2-enyl] propanedioate |
|---|---|
| PubChem CID | 11681305 |
| Molecular Formula | C14H24O4S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 3-O-tert-butyl 1-O-[(E)-3-(1-methylsulfanylpropylsulfanyl)prop-2-enyl] propanedioate |
| SMILES | CCC(SC)S/C=C/COC(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24O4S2/c1-6-13(19-5)20-9-7-8-17-11(15)10-12(16)18-14(2,3)4/h7,9,13H,6,8,10H2,1-5H3/b9-7+ |
| InChIKey | OHKKHGQRKQECNF-VQHVLOKHSA-N |
| XLogP | 3.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|