C12H22O3S2 — CID 155891863
3-(butan-2-yldisulfanyl)prop-2-enyl 3-hydroxy-3-methylbutanoate (PubChem CID 155891863) has the molecular formula C12H22O3S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 3-(butan-2-yldisulfanyl)prop-2-enyl 3-hydroxy-3-methylbutanoate.
| Compound Name | 3-(butan-2-yldisulfanyl)prop-2-enyl 3-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 155891863 |
| Molecular Formula | C12H22O3S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3-(butan-2-yldisulfanyl)prop-2-enyl 3-hydroxy-3-methylbutanoate |
| SMILES | CCC(C)SSC=CCOC(=O)CC(C)(C)O |
| InChI | InChI=1S/C12H22O3S2/c1-5-10(2)17-16-8-6-7-15-11(13)9-12(3,4)14/h6,8,10,14H,5,7,9H2,1-4H3 |
| InChIKey | JGSOKMZFTIETOS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|