C17H20N2O2 — CID 146183709
1-bicyclo[1.1.0]butanylmethyl N-[2-amino-5-(cyclopenten-1-yl)phenyl]carbamate (PubChem CID 146183709) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-bicyclo[1.1.0]butanylmethyl N-[2-amino-5-(cyclopenten-1-yl)phenyl]carbamate.
| Compound Name | 1-bicyclo[1.1.0]butanylmethyl N-[2-amino-5-(cyclopenten-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 146183709 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-bicyclo[1.1.0]butanylmethyl N-[2-amino-5-(cyclopenten-1-yl)phenyl]carbamate |
| SMILES | Nc1ccc(C2=CCCC2)cc1NC(=O)OCC12CC1C2 |
| InChI | InChI=1S/C17H20N2O2/c18-14-6-5-12(11-3-1-2-4-11)7-15(14)19-16(20)21-10-17-8-13(17)9-17/h3,5-7,13H,1-2,4,8-10,18H2,(H,19,20) |
| InChIKey | ZKEKVSSTIVKERB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|