About diphenyl ethanediimidothioate
diphenyl ethanediimidothioate (PubChem CID 14618450) has the molecular formula C14H12N2S2
and a molecular weight of 272.40 g/mol. Its IUPAC name is diphenyl ethanediimidothioate.
Molecular Properties
| Compound Name | diphenyl ethanediimidothioate |
| PubChem CID | 14618450 |
| Molecular Formula | C14H12N2S2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | diphenyl ethanediimidothioate |
| SMILES | [H]/N=C(Sc1ccccc1)\C(=N/[H])Sc1ccccc1 |
| InChI | InChI=1S/C14H12N2S2/c15-13(17-11-7-3-1-4-8-11)14(16)18-12-9-5-2-6-10-12/h1-10,15-16H/b15-13+,16-14+ |
| InChIKey | NRHYOSHCBUKRAW-WXUKJITCSA-N |
| XLogP | 4.53 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze diphenyl ethanediimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl ethanediimidothioate?
The IUPAC name of diphenyl ethanediimidothioate (CID 14618450) is diphenyl ethanediimidothioate.
What is the SMILES notation for diphenyl ethanediimidothioate?
The canonical SMILES for diphenyl ethanediimidothioate is [H]/N=C(Sc1ccccc1)\C(=N/[H])Sc1ccccc1.
What is the InChIKey of diphenyl ethanediimidothioate?
The InChIKey is NRHYOSHCBUKRAW-WXUKJITCSA-N. The full InChI is InChI=1S/C14H12N2S2/c15-13(17-11-7-3-1-4-8-11)14(16)18-12-9-5-2-6-10-12/h1-10,15-16H/b15-13+,16-14+.
What are the key properties of diphenyl ethanediimidothioate?
diphenyl ethanediimidothioate has a molecular weight of 272.40 g/mol, XLogP of 4.53, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl ethanediimidothioate is sourced from PubChem (CID 14618450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).