C18H24N6O2S — CID 146187733
[4-amino-5-methanimidoyl-6-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]pyrimidin-2-yl] methanesulfinate (PubChem CID 146187733) has the molecular formula C18H24N6O2S and a molecular weight of 388.50 g/mol. Its IUPAC name is [4-amino-5-methanimidoyl-6-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]pyrimidin-2-yl] methanesulfinate.
| Compound Name | [4-amino-5-methanimidoyl-6-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]pyrimidin-2-yl] methanesulfinate |
|---|---|
| PubChem CID | 146187733 |
| Molecular Formula | C18H24N6O2S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [4-amino-5-methanimidoyl-6-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]pyrimidin-2-yl] methanesulfinate |
| SMILES | [H]/N=C/c1c(N)nc(OS(C)=O)nc1NCc1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C18H24N6O2S/c1-27(25)26-18-22-16(20)15(10-19)17(23-18)21-11-13-4-6-14(7-5-13)12-24-8-2-3-9-24/h4-7,10,19H,2-3,8-9,11-12H2,1H3,(H3,20,21,22,23)/b19-10+ |
| InChIKey | QPCNRMTZVADSDD-VXLYETTFSA-N |
| XLogP | 1.94 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|