C20H26ClN5OS — CID 143703753
N-[5-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]-2-chlorophenyl]methanesulfinamide (PubChem CID 143703753) has the molecular formula C20H26ClN5OS and a molecular weight of 419.98 g/mol. Its IUPAC name is N-[5-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]-2-chlorophenyl]methanesulfinamide.
| Compound Name | N-[5-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]-2-chlorophenyl]methanesulfinamide |
|---|---|
| PubChem CID | 143703753 |
| Molecular Formula | C20H26ClN5OS |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[5-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]-2-chlorophenyl]methanesulfinamide |
| SMILES | [H]/N=C/c1cc(NC2CCCN(Cc3ccc(Cl)c(NS(C)=O)c3)C2)ccc1N |
| InChI | InChI=1S/C20H26ClN5OS/c1-28(27)25-20-9-14(4-6-18(20)21)12-26-8-2-3-17(13-26)24-16-5-7-19(23)15(10-16)11-22/h4-7,9-11,17,22,24-25H,2-3,8,12-13,23H2,1H3/b22-11+ |
| InChIKey | XJNJQALDPAHOJP-SSDVNMTOSA-N |
| XLogP | 3.70 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|