C21H28N4O2 — CID 143703793
2-[3-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]phenoxy]ethanol (PubChem CID 143703793) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[3-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[3-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 143703793 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2-[3-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]phenoxy]ethanol |
| SMILES | [H]/N=C/c1cc(NC2CCCN(Cc3cccc(OCCO)c3)C2)ccc1N |
| InChI | InChI=1S/C21H28N4O2/c22-13-17-12-18(6-7-21(17)23)24-19-4-2-8-25(15-19)14-16-3-1-5-20(11-16)27-10-9-26/h1,3,5-7,11-13,19,22,24,26H,2,4,8-10,14-15,23H2/b22-13+ |
| InChIKey | FPNHKTCTCIKUPE-LPYMAVHISA-N |
| XLogP | 2.71 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|