C19H25N5S — CID 143703801
S-[3-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]phenyl]thiohydroxylamine (PubChem CID 143703801) has the molecular formula C19H25N5S and a molecular weight of 355.51 g/mol. Its IUPAC name is S-[3-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]phenyl]thiohydroxylamine.
| Compound Name | S-[3-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 143703801 |
| Molecular Formula | C19H25N5S |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | S-[3-[[3-(4-amino-3-methanimidoylanilino)piperidin-1-yl]methyl]phenyl]thiohydroxylamine |
| SMILES | [H]/N=C/c1cc(NC2CCCN(Cc3cccc(SN)c3)C2)ccc1N |
| InChI | InChI=1S/C19H25N5S/c20-11-15-10-16(6-7-19(15)21)23-17-4-2-8-24(13-17)12-14-3-1-5-18(9-14)25-22/h1,3,5-7,9-11,17,20,23H,2,4,8,12-13,21-22H2/b20-11+ |
| InChIKey | AUEXPZXNDNZANZ-RGVLZGJSSA-N |
| XLogP | 3.31 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|